C14H26N4O3S — CID 110938928
1-ethyl-3-[3-[ethyl(methylsulfonyl)amino]propyl]-2-(furan-2-ylmethyl)guanidine (PubChem CID 110938928) has the molecular formula C14H26N4O3S and a molecular weight of 330.45 g/mol. Its IUPAC name is 1-ethyl-3-[3-[ethyl(methylsulfonyl)amino]propyl]-2-(furan-2-ylmethyl)guanidine.
| Compound Name | 1-ethyl-3-[3-[ethyl(methylsulfonyl)amino]propyl]-2-(furan-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 110938928 |
| Molecular Formula | C14H26N4O3S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 1-ethyl-3-[3-[ethyl(methylsulfonyl)amino]propyl]-2-(furan-2-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccco1)NCCCN(CC)S(C)(=O)=O |
| InChI | InChI=1S/C14H26N4O3S/c1-4-15-14(17-12-13-8-6-11-21-13)16-9-7-10-18(5-2)22(3,19)20/h6,8,11H,4-5,7,9-10,12H2,1-3H3,(H2,15,16,17) |
| InChIKey | PNOKWHHTHUVYEC-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|