C14H23F3IN5 — CID 111547410
1-ethyl-3-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-2-(pyridin-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111547410) has the molecular formula C14H23F3IN5 and a molecular weight of 445.27 g/mol. Its IUPAC name is 1-ethyl-3-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-2-(pyridin-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-2-(pyridin-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111547410 |
| Molecular Formula | C14H23F3IN5 |
| Molecular Weight | 445.27 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 1-ethyl-3-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-2-(pyridin-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccn1)NCCN(C)CC(F)(F)F.I |
| InChI | InChI=1S/C14H22F3N5.HI/c1-3-18-13(21-10-12-6-4-5-7-19-12)20-8-9-22(2)11-14(15,16)17;/h4-7H,3,8-11H2,1-2H3,(H2,18,20,21);1H |
| InChIKey | SCUNWDVZXWDYDE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|