C14H23IN4 — CID 111587968
1-ethyl-3-pent-3-enyl-2-(pyridin-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111587968) has the molecular formula C14H23IN4 and a molecular weight of 374.27 g/mol. Its IUPAC name is 1-ethyl-3-pent-3-enyl-2-(pyridin-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-pent-3-enyl-2-(pyridin-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111587968 |
| Molecular Formula | C14H23IN4 |
| Molecular Weight | 374.27 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 1-ethyl-3-pent-3-enyl-2-(pyridin-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CC=CCCN/C(=N/Cc1ccccn1)NCC.I |
| InChI | InChI=1S/C14H22N4.HI/c1-3-5-7-11-17-14(15-4-2)18-12-13-9-6-8-10-16-13;/h3,5-6,8-10H,4,7,11-12H2,1-2H3,(H2,15,17,18);1H |
| InChIKey | DWTHGCCTNOSPBM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|