C16H27IN4O2 — CID 110969981
methyl 6-[[N-ethyl-N'-(pyridin-2-ylmethyl)carbamimidoyl]amino]hexanoate;hydroiodide (PubChem CID 110969981) has the molecular formula C16H27IN4O2 and a molecular weight of 434.32 g/mol. Its IUPAC name is methyl 6-[[N-ethyl-N'-(pyridin-2-ylmethyl)carbamimidoyl]amino]hexanoate;hydroiodide.
| Compound Name | methyl 6-[[N-ethyl-N'-(pyridin-2-ylmethyl)carbamimidoyl]amino]hexanoate;hydroiodide |
|---|---|
| PubChem CID | 110969981 |
| Molecular Formula | C16H27IN4O2 |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | methyl 6-[[N-ethyl-N'-(pyridin-2-ylmethyl)carbamimidoyl]amino]hexanoate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccn1)NCCCCCC(=O)OC.I |
| InChI | InChI=1S/C16H26N4O2.HI/c1-3-17-16(20-13-14-9-6-8-11-18-14)19-12-7-4-5-10-15(21)22-2;/h6,8-9,11H,3-5,7,10,12-13H2,1-2H3,(H2,17,19,20);1H |
| InChIKey | PWYWEJCLQHJLDB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|