C17H28N4O2 — CID 111194562
methyl 6-[[ethylamino-(2-pyridin-2-ylethylamino)methylidene]amino]hexanoate (PubChem CID 111194562) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is methyl 6-[[ethylamino-(2-pyridin-2-ylethylamino)methylidene]amino]hexanoate.
| Compound Name | methyl 6-[[ethylamino-(2-pyridin-2-ylethylamino)methylidene]amino]hexanoate |
|---|---|
| PubChem CID | 111194562 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | methyl 6-[[ethylamino-(2-pyridin-2-ylethylamino)methylidene]amino]hexanoate |
| SMILES | CCN/C(=N\CCCCCC(=O)OC)NCCc1ccccn1 |
| InChI | InChI=1S/C17H28N4O2/c1-3-18-17(20-13-7-4-5-10-16(22)23-2)21-14-11-15-9-6-8-12-19-15/h6,8-9,12H,3-5,7,10-11,13-14H2,1-2H3,(H2,18,20,21) |
| InChIKey | HFMWRPYYPNRZOS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|