C15H28IN5 — CID 110969393
1-[2-(diethylamino)ethyl]-3-ethyl-2-(pyridin-2-ylmethyl)guanidine;hydroiodide (PubChem CID 110969393) has the molecular formula C15H28IN5 and a molecular weight of 405.33 g/mol. Its IUPAC name is 1-[2-(diethylamino)ethyl]-3-ethyl-2-(pyridin-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(diethylamino)ethyl]-3-ethyl-2-(pyridin-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110969393 |
| Molecular Formula | C15H28IN5 |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 1-[2-(diethylamino)ethyl]-3-ethyl-2-(pyridin-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccn1)NCCN(CC)CC.I |
| InChI | InChI=1S/C15H27N5.HI/c1-4-16-15(18-11-12-20(5-2)6-3)19-13-14-9-7-8-10-17-14;/h7-10H,4-6,11-13H2,1-3H3,(H2,16,18,19);1H |
| InChIKey | PSBZWQKSMVAKAJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|