C19H27FIN5 — CID 110971402
1-ethyl-3-[3-(3-fluoro-N-methylanilino)propyl]-2-(pyridin-2-ylmethyl)guanidine;hydroiodide (PubChem CID 110971402) has the molecular formula C19H27FIN5 and a molecular weight of 471.36 g/mol. Its IUPAC name is 1-ethyl-3-[3-(3-fluoro-N-methylanilino)propyl]-2-(pyridin-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-(3-fluoro-N-methylanilino)propyl]-2-(pyridin-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110971402 |
| Molecular Formula | C19H27FIN5 |
| Molecular Weight | 471.36 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 1-ethyl-3-[3-(3-fluoro-N-methylanilino)propyl]-2-(pyridin-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccn1)NCCCN(C)c1cccc(F)c1.I |
| InChI | InChI=1S/C19H26FN5.HI/c1-3-21-19(24-15-17-9-4-5-11-22-17)23-12-7-13-25(2)18-10-6-8-16(20)14-18;/h4-6,8-11,14H,3,7,12-13,15H2,1-2H3,(H2,21,23,24);1H |
| InChIKey | IJMUIIYWFHBQKH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|