C20H24F2N4O — CID 111903291
N-[3-[[N'-[(2,5-difluorophenyl)methyl]-N-ethylcarbamimidoyl]amino]propyl]benzamide (PubChem CID 111903291) has the molecular formula C20H24F2N4O and a molecular weight of 374.44 g/mol. Its IUPAC name is N-[3-[[N'-[(2,5-difluorophenyl)methyl]-N-ethylcarbamimidoyl]amino]propyl]benzamide.
| Compound Name | N-[3-[[N'-[(2,5-difluorophenyl)methyl]-N-ethylcarbamimidoyl]amino]propyl]benzamide |
|---|---|
| PubChem CID | 111903291 |
| Molecular Formula | C20H24F2N4O |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | N-[3-[[N'-[(2,5-difluorophenyl)methyl]-N-ethylcarbamimidoyl]amino]propyl]benzamide |
| SMILES | CCN/C(=N\Cc1cc(F)ccc1F)NCCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H24F2N4O/c1-2-23-20(26-14-16-13-17(21)9-10-18(16)22)25-12-6-11-24-19(27)15-7-4-3-5-8-15/h3-5,7-10,13H,2,6,11-12,14H2,1H3,(H,24,27)(H2,23,25,26) |
| InChIKey | QKTOQKSEMJYUMT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|