C15H25F2IN4O2S — CID 111903056
2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[3-(ethylsulfonylamino)propyl]guanidine;hydroiodide (PubChem CID 111903056) has the molecular formula C15H25F2IN4O2S and a molecular weight of 490.36 g/mol. Its IUPAC name is 2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[3-(ethylsulfonylamino)propyl]guanidine;hydroiodide.
| Compound Name | 2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[3-(ethylsulfonylamino)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111903056 |
| Molecular Formula | C15H25F2IN4O2S |
| Molecular Weight | 490.36 g/mol |
| Exact Mass | 490.07 |
| IUPAC Name | 2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[3-(ethylsulfonylamino)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(F)ccc1F)NCCCNS(=O)(=O)CC.I |
| InChI | InChI=1S/C15H24F2N4O2S.HI/c1-3-18-15(19-8-5-9-21-24(22,23)4-2)20-11-12-10-13(16)6-7-14(12)17;/h6-7,10,21H,3-5,8-9,11H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | LPBWNLOINDWEFT-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|