C18H31F2IN4 — CID 111903006
2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[4-[methyl(propan-2-yl)amino]butyl]guanidine;hydroiodide (PubChem CID 111903006) has the molecular formula C18H31F2IN4 and a molecular weight of 468.37 g/mol. Its IUPAC name is 2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[4-[methyl(propan-2-yl)amino]butyl]guanidine;hydroiodide.
| Compound Name | 2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[4-[methyl(propan-2-yl)amino]butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111903006 |
| Molecular Formula | C18H31F2IN4 |
| Molecular Weight | 468.37 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[4-[methyl(propan-2-yl)amino]butyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(F)ccc1F)NCCCCN(C)C(C)C.I |
| InChI | InChI=1S/C18H30F2N4.HI/c1-5-21-18(22-10-6-7-11-24(4)14(2)3)23-13-15-12-16(19)8-9-17(15)20;/h8-9,12,14H,5-7,10-11,13H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | DVBBIBQXTQFTJI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|