C14H22F2N4O2S — CID 111901681
2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[3-(methanesulfonamido)propyl]guanidine (PubChem CID 111901681) has the molecular formula C14H22F2N4O2S and a molecular weight of 348.42 g/mol. Its IUPAC name is 2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[3-(methanesulfonamido)propyl]guanidine.
| Compound Name | 2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[3-(methanesulfonamido)propyl]guanidine |
|---|---|
| PubChem CID | 111901681 |
| Molecular Formula | C14H22F2N4O2S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[3-(methanesulfonamido)propyl]guanidine |
| SMILES | CCN/C(=N\Cc1cc(F)ccc1F)NCCCNS(C)(=O)=O |
| InChI | InChI=1S/C14H22F2N4O2S/c1-3-17-14(18-7-4-8-20-23(2,21)22)19-10-11-9-12(15)5-6-13(11)16/h5-6,9,20H,3-4,7-8,10H2,1-2H3,(H2,17,18,19) |
| InChIKey | ZMISTFVXJWKESZ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|