C17H28F2IN3O — CID 111783091
1-(3-butoxypropyl)-2-[(2,5-difluorophenyl)methyl]-3-ethylguanidine;hydroiodide (PubChem CID 111783091) has the molecular formula C17H28F2IN3O and a molecular weight of 455.33 g/mol. Its IUPAC name is 1-(3-butoxypropyl)-2-[(2,5-difluorophenyl)methyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-(3-butoxypropyl)-2-[(2,5-difluorophenyl)methyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111783091 |
| Molecular Formula | C17H28F2IN3O |
| Molecular Weight | 455.33 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 1-(3-butoxypropyl)-2-[(2,5-difluorophenyl)methyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCCCOCCCN/C(=N/Cc1cc(F)ccc1F)NCC.I |
| InChI | InChI=1S/C17H27F2N3O.HI/c1-3-5-10-23-11-6-9-21-17(20-4-2)22-13-14-12-15(18)7-8-16(14)19;/h7-8,12H,3-6,9-11,13H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | IXJDQERGTRSRMZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|