C21H27F2N3O2 — CID 111902011
2-[(2,5-difluorophenyl)methyl]-1-[3-(3,4-dimethoxyphenyl)propyl]-3-ethylguanidine (PubChem CID 111902011) has the molecular formula C21H27F2N3O2 and a molecular weight of 391.46 g/mol. Its IUPAC name is 2-[(2,5-difluorophenyl)methyl]-1-[3-(3,4-dimethoxyphenyl)propyl]-3-ethylguanidine.
| Compound Name | 2-[(2,5-difluorophenyl)methyl]-1-[3-(3,4-dimethoxyphenyl)propyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111902011 |
| Molecular Formula | C21H27F2N3O2 |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 2-[(2,5-difluorophenyl)methyl]-1-[3-(3,4-dimethoxyphenyl)propyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1cc(F)ccc1F)NCCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C21H27F2N3O2/c1-4-24-21(26-14-16-13-17(22)8-9-18(16)23)25-11-5-6-15-7-10-19(27-2)20(12-15)28-3/h7-10,12-13H,4-6,11,14H2,1-3H3,(H2,24,25,26) |
| InChIKey | XDEVEFOEQDTKOJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|