C24H35N3O4 — CID 111574255
2-[(2,3-dimethoxyphenyl)methyl]-1-[3-(3-ethoxy-4-methoxyphenyl)propyl]-3-ethylguanidine (PubChem CID 111574255) has the molecular formula C24H35N3O4 and a molecular weight of 429.56 g/mol. Its IUPAC name is 2-[(2,3-dimethoxyphenyl)methyl]-1-[3-(3-ethoxy-4-methoxyphenyl)propyl]-3-ethylguanidine.
| Compound Name | 2-[(2,3-dimethoxyphenyl)methyl]-1-[3-(3-ethoxy-4-methoxyphenyl)propyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111574255 |
| Molecular Formula | C24H35N3O4 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | 2-[(2,3-dimethoxyphenyl)methyl]-1-[3-(3-ethoxy-4-methoxyphenyl)propyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1cccc(OC)c1OC)NCCCc1ccc(OC)c(OCC)c1 |
| InChI | InChI=1S/C24H35N3O4/c1-6-25-24(27-17-19-11-8-12-21(29-4)23(19)30-5)26-15-9-10-18-13-14-20(28-3)22(16-18)31-7-2/h8,11-14,16H,6-7,9-10,15,17H2,1-5H3,(H2,25,26,27) |
| InChIKey | NGFUMOLJELBXBM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|