C14H22F2IN3 — CID 111781289
1-butyl-2-[(2,5-difluorophenyl)methyl]-3-ethylguanidine;hydroiodide (PubChem CID 111781289) has the molecular formula C14H22F2IN3 and a molecular weight of 397.25 g/mol. Its IUPAC name is 1-butyl-2-[(2,5-difluorophenyl)methyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-butyl-2-[(2,5-difluorophenyl)methyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111781289 |
| Molecular Formula | C14H22F2IN3 |
| Molecular Weight | 397.25 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 1-butyl-2-[(2,5-difluorophenyl)methyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCCCN/C(=N/Cc1cc(F)ccc1F)NCC.I |
| InChI | InChI=1S/C14H21F2N3.HI/c1-3-5-8-18-14(17-4-2)19-10-11-9-12(15)6-7-13(11)16;/h6-7,9H,3-5,8,10H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | BVCYHTCJLSNYEB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.25 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|