C16H26FIN4O — CID 111231110
N-[2-[[N-ethyl-N'-[(4-fluorophenyl)methyl]carbamimidoyl]amino]ethyl]-2-methylpropanamide;hydroiodide (PubChem CID 111231110) has the molecular formula C16H26FIN4O and a molecular weight of 436.31 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[(4-fluorophenyl)methyl]carbamimidoyl]amino]ethyl]-2-methylpropanamide;hydroiodide.
| Compound Name | N-[2-[[N-ethyl-N'-[(4-fluorophenyl)methyl]carbamimidoyl]amino]ethyl]-2-methylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111231110 |
| Molecular Formula | C16H26FIN4O |
| Molecular Weight | 436.31 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[(4-fluorophenyl)methyl]carbamimidoyl]amino]ethyl]-2-methylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(F)cc1)NCCNC(=O)C(C)C.I |
| InChI | InChI=1S/C16H25FN4O.HI/c1-4-18-16(20-10-9-19-15(22)12(2)3)21-11-13-5-7-14(17)8-6-13;/h5-8,12H,4,9-11H2,1-3H3,(H,19,22)(H2,18,20,21);1H |
| InChIKey | KBQKOYMCOVSLJY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|