C18H29FN4OS — CID 111310826
N-[2-[[N-ethyl-N'-[3-(4-fluorophenyl)sulfanylpropyl]carbamimidoyl]amino]ethyl]-2-methylpropanamide (PubChem CID 111310826) has the molecular formula C18H29FN4OS and a molecular weight of 368.52 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[3-(4-fluorophenyl)sulfanylpropyl]carbamimidoyl]amino]ethyl]-2-methylpropanamide.
| Compound Name | N-[2-[[N-ethyl-N'-[3-(4-fluorophenyl)sulfanylpropyl]carbamimidoyl]amino]ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 111310826 |
| Molecular Formula | C18H29FN4OS |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[3-(4-fluorophenyl)sulfanylpropyl]carbamimidoyl]amino]ethyl]-2-methylpropanamide |
| SMILES | CCN/C(=N\CCCSc1ccc(F)cc1)NCCNC(=O)C(C)C |
| InChI | InChI=1S/C18H29FN4OS/c1-4-20-18(23-12-11-21-17(24)14(2)3)22-10-5-13-25-16-8-6-15(19)7-9-16/h6-9,14H,4-5,10-13H2,1-3H3,(H,21,24)(H2,20,22,23) |
| InChIKey | NKVAFKDZZXXRTD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|