C16H26FIN4OS — CID 111311567
2-[[ethylamino-[3-(4-fluorophenyl)sulfanylpropylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111311567) has the molecular formula C16H26FIN4OS and a molecular weight of 468.38 g/mol. Its IUPAC name is 2-[[ethylamino-[3-(4-fluorophenyl)sulfanylpropylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-[3-(4-fluorophenyl)sulfanylpropylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111311567 |
| Molecular Formula | C16H26FIN4OS |
| Molecular Weight | 468.38 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 2-[[ethylamino-[3-(4-fluorophenyl)sulfanylpropylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)N(C)C)NCCCSc1ccc(F)cc1.I |
| InChI | InChI=1S/C16H25FN4OS.HI/c1-4-18-16(20-12-15(22)21(2)3)19-10-5-11-23-14-8-6-13(17)7-9-14;/h6-9H,4-5,10-12H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | TWLVSGDZEYRMMU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|