C18H26FN5S2 — CID 111964791
2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]guanidine (PubChem CID 111964791) has the molecular formula C18H26FN5S2 and a molecular weight of 395.57 g/mol. Its IUPAC name is 2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]guanidine.
| Compound Name | 2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]guanidine |
|---|---|
| PubChem CID | 111964791 |
| Molecular Formula | C18H26FN5S2 |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]guanidine |
| SMILES | CCN/C(=N\Cc1csc(N(C)C)n1)NCCCSc1ccc(F)cc1 |
| InChI | InChI=1S/C18H26FN5S2/c1-4-20-17(22-12-15-13-26-18(23-15)24(2)3)21-10-5-11-25-16-8-6-14(19)7-9-16/h6-9,13H,4-5,10-12H2,1-3H3,(H2,20,21,22) |
| InChIKey | QQDSCOPKKDMDGR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|