C17H23FN4S2 — CID 111310842
1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-[(4-methyl-1,3-thiazol-5-yl)methyl]guanidine (PubChem CID 111310842) has the molecular formula C17H23FN4S2 and a molecular weight of 366.53 g/mol. Its IUPAC name is 1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-[(4-methyl-1,3-thiazol-5-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-[(4-methyl-1,3-thiazol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111310842 |
| Molecular Formula | C17H23FN4S2 |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-[(4-methyl-1,3-thiazol-5-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1scnc1C)NCCCSc1ccc(F)cc1 |
| InChI | InChI=1S/C17H23FN4S2/c1-3-19-17(21-11-16-13(2)22-12-24-16)20-9-4-10-23-15-7-5-14(18)6-8-15/h5-8,12H,3-4,9-11H2,1-2H3,(H2,19,20,21) |
| InChIKey | FDSHQWCIOCOFTC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|