C18H22FN5S2 — CID 111310990
1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)guanidine (PubChem CID 111310990) has the molecular formula C18H22FN5S2 and a molecular weight of 391.54 g/mol. Its IUPAC name is 1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)guanidine.
| Compound Name | 1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111310990 |
| Molecular Formula | C18H22FN5S2 |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1cn2ccsc2n1)NCCCSc1ccc(F)cc1 |
| InChI | InChI=1S/C18H22FN5S2/c1-2-20-17(22-12-15-13-24-9-11-26-18(24)23-15)21-8-3-10-25-16-6-4-14(19)5-7-16/h4-7,9,11,13H,2-3,8,10,12H2,1H3,(H2,20,21,22) |
| InChIKey | LWAUPCYSWPNKKM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 53.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|