C13H21N5S — CID 110965922
1-tert-butyl-3-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)guanidine (PubChem CID 110965922) has the molecular formula C13H21N5S and a molecular weight of 279.41 g/mol. Its IUPAC name is 1-tert-butyl-3-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)guanidine.
| Compound Name | 1-tert-butyl-3-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)guanidine |
|---|---|
| PubChem CID | 110965922 |
| Molecular Formula | C13H21N5S |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 1-tert-butyl-3-ethyl-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1cn2ccsc2n1)NC(C)(C)C |
| InChI | InChI=1S/C13H21N5S/c1-5-14-11(17-13(2,3)4)15-8-10-9-18-6-7-19-12(18)16-10/h6-7,9H,5,8H2,1-4H3,(H2,14,15,17) |
| InChIKey | YLBNRDWEZUIXKO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 53.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|