C16H21N5OS2 — CID 109420376
1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)guanidine (PubChem CID 109420376) has the molecular formula C16H21N5OS2 and a molecular weight of 363.51 g/mol. Its IUPAC name is 1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)guanidine.
| Compound Name | 1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109420376 |
| Molecular Formula | C16H21N5OS2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1cn2ccsc2n1)NCC(C)(O)c1cccs1 |
| InChI | InChI=1S/C16H21N5OS2/c1-3-17-14(19-11-16(2,22)13-5-4-7-23-13)18-9-12-10-21-6-8-24-15(21)20-12/h4-8,10,22H,3,9,11H2,1-2H3,(H2,17,18,19) |
| InChIKey | SNZFFNVDFLUWJJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 73.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|