C17H21N5S — CID 111243953
1-ethyl-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-[(4-methylphenyl)methyl]guanidine (PubChem CID 111243953) has the molecular formula C17H21N5S and a molecular weight of 327.46 g/mol. Its IUPAC name is 1-ethyl-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-[(4-methylphenyl)methyl]guanidine.
| Compound Name | 1-ethyl-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-[(4-methylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111243953 |
| Molecular Formula | C17H21N5S |
| Molecular Weight | 327.46 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 1-ethyl-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-[(4-methylphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(C)cc1)NCc1cn2ccsc2n1 |
| InChI | InChI=1S/C17H21N5S/c1-3-18-16(19-10-14-6-4-13(2)5-7-14)20-11-15-12-22-8-9-23-17(22)21-15/h4-9,12H,3,10-11H2,1-2H3,(H2,18,19,20) |
| InChIKey | JYINJQQDUGOXOH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 53.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|