C22H30N6S — CID 111410987
1-ethyl-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-[[4-(piperidin-1-ylmethyl)phenyl]methyl]guanidine (PubChem CID 111410987) has the molecular formula C22H30N6S and a molecular weight of 410.59 g/mol. Its IUPAC name is 1-ethyl-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-[[4-(piperidin-1-ylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-[[4-(piperidin-1-ylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111410987 |
| Molecular Formula | C22H30N6S |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 1-ethyl-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-[[4-(piperidin-1-ylmethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(CN2CCCCC2)cc1)NCc1cn2ccsc2n1 |
| InChI | InChI=1S/C22H30N6S/c1-2-23-21(25-15-20-17-28-12-13-29-22(28)26-20)24-14-18-6-8-19(9-7-18)16-27-10-4-3-5-11-27/h6-9,12-13,17H,2-5,10-11,14-16H2,1H3,(H2,23,24,25) |
| InChIKey | OFMGRLSFABKEHB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 56.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|