C18H21F3IN5OS — CID 111871748
1-ethyl-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111871748) has the molecular formula C18H21F3IN5OS and a molecular weight of 539.37 g/mol. Its IUPAC name is 1-ethyl-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111871748 |
| Molecular Formula | C18H21F3IN5OS |
| Molecular Weight | 539.37 g/mol |
| Exact Mass | 539.05 |
| IUPAC Name | 1-ethyl-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OCC(F)(F)F)cc1)NCc1cn2ccsc2n1.I |
| InChI | InChI=1S/C18H20F3N5OS.HI/c1-2-22-16(24-10-14-11-26-7-8-28-17(26)25-14)23-9-13-3-5-15(6-4-13)27-12-18(19,20)21;/h3-8,11H,2,9-10,12H2,1H3,(H2,22,23,24);1H |
| InChIKey | RZMIDNCCIJBIGF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 62.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|