C18H23F3N4OS — CID 111871607
1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine (PubChem CID 111871607) has the molecular formula C18H23F3N4OS and a molecular weight of 400.47 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111871607 |
| Molecular Formula | C18H23F3N4OS |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(OCC(F)(F)F)cc1)NCCc1csc(C)n1 |
| InChI | InChI=1S/C18H23F3N4OS/c1-3-22-17(23-9-8-15-11-27-13(2)25-15)24-10-14-4-6-16(7-5-14)26-12-18(19,20)21/h4-7,11H,3,8-10,12H2,1-2H3,(H2,22,23,24) |
| InChIKey | AIHPYUQVHVBWSB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|