C15H23F3IN3O2 — CID 110939893
1-ethyl-3-(2-methoxyethyl)-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 110939893) has the molecular formula C15H23F3IN3O2 and a molecular weight of 461.27 g/mol. Its IUPAC name is 1-ethyl-3-(2-methoxyethyl)-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-methoxyethyl)-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110939893 |
| Molecular Formula | C15H23F3IN3O2 |
| Molecular Weight | 461.27 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 1-ethyl-3-(2-methoxyethyl)-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OCC(F)(F)F)cc1)NCCOC.I |
| InChI | InChI=1S/C15H22F3N3O2.HI/c1-3-19-14(20-8-9-22-2)21-10-12-4-6-13(7-5-12)23-11-15(16,17)18;/h4-7H,3,8-11H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | XRFRZXMJPUSDEF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.27 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|