C19H29F3N4O3 — CID 111872665
tert-butyl N-[2-[[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]ethyl]carbamate (PubChem CID 111872665) has the molecular formula C19H29F3N4O3 and a molecular weight of 418.46 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 111872665 |
| Molecular Formula | C19H29F3N4O3 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | tert-butyl N-[2-[[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]ethyl]carbamate |
| SMILES | CCN/C(=N\Cc1ccc(OCC(F)(F)F)cc1)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H29F3N4O3/c1-5-23-16(24-10-11-25-17(27)29-18(2,3)4)26-12-14-6-8-15(9-7-14)28-13-19(20,21)22/h6-9H,5,10-13H2,1-4H3,(H,25,27)(H2,23,24,26) |
| InChIKey | WNYLXVCFAPFFHH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|