C19H31N5O4 — CID 111885637
methyl N-[4-[[[ethylamino-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]methylidene]amino]methyl]phenyl]carbamate (PubChem CID 111885637) has the molecular formula C19H31N5O4 and a molecular weight of 393.49 g/mol. Its IUPAC name is methyl N-[4-[[[ethylamino-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]methylidene]amino]methyl]phenyl]carbamate.
| Compound Name | methyl N-[4-[[[ethylamino-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]methylidene]amino]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 111885637 |
| Molecular Formula | C19H31N5O4 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | methyl N-[4-[[[ethylamino-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]methylidene]amino]methyl]phenyl]carbamate |
| SMILES | CCN/C(=N\Cc1ccc(NC(=O)OC)cc1)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H31N5O4/c1-6-20-16(21-11-12-22-17(25)28-19(2,3)4)23-13-14-7-9-15(10-8-14)24-18(26)27-5/h7-10H,6,11-13H2,1-5H3,(H,22,25)(H,24,26)(H2,20,21,23) |
| InChIKey | FOEDZENHTOOGIP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|