C20H35N5O2 — CID 111248817
methyl N-[4-[[[[2-[di(propan-2-yl)amino]ethylamino]-(ethylamino)methylidene]amino]methyl]phenyl]carbamate (PubChem CID 111248817) has the molecular formula C20H35N5O2 and a molecular weight of 377.53 g/mol. Its IUPAC name is methyl N-[4-[[[[2-[di(propan-2-yl)amino]ethylamino]-(ethylamino)methylidene]amino]methyl]phenyl]carbamate.
| Compound Name | methyl N-[4-[[[[2-[di(propan-2-yl)amino]ethylamino]-(ethylamino)methylidene]amino]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 111248817 |
| Molecular Formula | C20H35N5O2 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.28 |
| IUPAC Name | methyl N-[4-[[[[2-[di(propan-2-yl)amino]ethylamino]-(ethylamino)methylidene]amino]methyl]phenyl]carbamate |
| SMILES | CCN/C(=N\Cc1ccc(NC(=O)OC)cc1)NCCN(C(C)C)C(C)C |
| InChI | InChI=1S/C20H35N5O2/c1-7-21-19(22-12-13-25(15(2)3)16(4)5)23-14-17-8-10-18(11-9-17)24-20(26)27-6/h8-11,15-16H,7,12-14H2,1-6H3,(H,24,26)(H2,21,22,23) |
| InChIKey | MAQWQRZDRKAKSD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|