C16H27IN4O2 — CID 110966331
methyl N-[4-[[[(tert-butylamino)-(ethylamino)methylidene]amino]methyl]phenyl]carbamate;hydroiodide (PubChem CID 110966331) has the molecular formula C16H27IN4O2 and a molecular weight of 434.32 g/mol. Its IUPAC name is methyl N-[4-[[[(tert-butylamino)-(ethylamino)methylidene]amino]methyl]phenyl]carbamate;hydroiodide.
| Compound Name | methyl N-[4-[[[(tert-butylamino)-(ethylamino)methylidene]amino]methyl]phenyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 110966331 |
| Molecular Formula | C16H27IN4O2 |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | methyl N-[4-[[[(tert-butylamino)-(ethylamino)methylidene]amino]methyl]phenyl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(NC(=O)OC)cc1)NC(C)(C)C.I |
| InChI | InChI=1S/C16H26N4O2.HI/c1-6-17-14(20-16(2,3)4)18-11-12-7-9-13(10-8-12)19-15(21)22-5;/h7-10H,6,11H2,1-5H3,(H,19,21)(H2,17,18,20);1H |
| InChIKey | ITSSYVLQKBCKKA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|