C18H24IN5O2 — CID 110970080
methyl N-[4-[[[ethylamino-(pyridin-2-ylmethylamino)methylidene]amino]methyl]phenyl]carbamate;hydroiodide (PubChem CID 110970080) has the molecular formula C18H24IN5O2 and a molecular weight of 469.33 g/mol. Its IUPAC name is methyl N-[4-[[[ethylamino-(pyridin-2-ylmethylamino)methylidene]amino]methyl]phenyl]carbamate;hydroiodide.
| Compound Name | methyl N-[4-[[[ethylamino-(pyridin-2-ylmethylamino)methylidene]amino]methyl]phenyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 110970080 |
| Molecular Formula | C18H24IN5O2 |
| Molecular Weight | 469.33 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | methyl N-[4-[[[ethylamino-(pyridin-2-ylmethylamino)methylidene]amino]methyl]phenyl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(NC(=O)OC)cc1)NCc1ccccn1.I |
| InChI | InChI=1S/C18H23N5O2.HI/c1-3-19-17(22-13-16-6-4-5-11-20-16)21-12-14-7-9-15(10-8-14)23-18(24)25-2;/h4-11H,3,12-13H2,1-2H3,(H,23,24)(H2,19,21,22);1H |
| InChIKey | AKVNBKFLEGVONL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|