C21H30IN5O — CID 110968809
N-butyl-4-[[[ethylamino-(pyridin-2-ylmethylamino)methylidene]amino]methyl]benzamide;hydroiodide (PubChem CID 110968809) has the molecular formula C21H30IN5O and a molecular weight of 495.41 g/mol. Its IUPAC name is N-butyl-4-[[[ethylamino-(pyridin-2-ylmethylamino)methylidene]amino]methyl]benzamide;hydroiodide.
| Compound Name | N-butyl-4-[[[ethylamino-(pyridin-2-ylmethylamino)methylidene]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 110968809 |
| Molecular Formula | C21H30IN5O |
| Molecular Weight | 495.41 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | N-butyl-4-[[[ethylamino-(pyridin-2-ylmethylamino)methylidene]amino]methyl]benzamide;hydroiodide |
| SMILES | CCCCNC(=O)c1ccc(C/N=C(\NCC)NCc2ccccn2)cc1.I |
| InChI | InChI=1S/C21H29N5O.HI/c1-3-5-13-24-20(27)18-11-9-17(10-12-18)15-25-21(22-4-2)26-16-19-8-6-7-14-23-19;/h6-12,14H,3-5,13,15-16H2,1-2H3,(H,24,27)(H2,22,25,26);1H |
| InChIKey | NFSFYMBTJVGSET-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|