C22H42IN5O2S — CID 111246852
1-[2-[di(propan-2-yl)amino]ethyl]-3-ethyl-2-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]guanidine;hydroiodide (PubChem CID 111246852) has the molecular formula C22H42IN5O2S and a molecular weight of 567.58 g/mol. Its IUPAC name is 1-[2-[di(propan-2-yl)amino]ethyl]-3-ethyl-2-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-[di(propan-2-yl)amino]ethyl]-3-ethyl-2-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111246852 |
| Molecular Formula | C22H42IN5O2S |
| Molecular Weight | 567.58 g/mol |
| Exact Mass | 567.21 |
| IUPAC Name | 1-[2-[di(propan-2-yl)amino]ethyl]-3-ethyl-2-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(S(=O)(=O)N(C)C(C)C)cc1)NCCN(C(C)C)C(C)C.I |
| InChI | InChI=1S/C22H41N5O2S.HI/c1-9-23-22(24-14-15-27(18(4)5)19(6)7)25-16-20-10-12-21(13-11-20)30(28,29)26(8)17(2)3;/h10-13,17-19H,9,14-16H2,1-8H3,(H2,23,24,25);1H |
| InChIKey | HOFYHCPPLSBKHH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.58 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|