C23H34N4O3S — CID 109417820
1-ethyl-3-(2-hydroxy-2-phenylpropyl)-2-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]guanidine (PubChem CID 109417820) has the molecular formula C23H34N4O3S and a molecular weight of 446.62 g/mol. Its IUPAC name is 1-ethyl-3-(2-hydroxy-2-phenylpropyl)-2-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-(2-hydroxy-2-phenylpropyl)-2-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 109417820 |
| Molecular Formula | C23H34N4O3S |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | 1-ethyl-3-(2-hydroxy-2-phenylpropyl)-2-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(S(=O)(=O)N(C)C(C)C)cc1)NCC(C)(O)c1ccccc1 |
| InChI | InChI=1S/C23H34N4O3S/c1-6-24-22(26-17-23(4,28)20-10-8-7-9-11-20)25-16-19-12-14-21(15-13-19)31(29,30)27(5)18(2)3/h7-15,18,28H,6,16-17H2,1-5H3,(H2,24,25,26) |
| InChIKey | QNKURGCIRBLJIA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|