C19H28N4O3S2 — CID 109418882
2-[[4-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine (PubChem CID 109418882) has the molecular formula C19H28N4O3S2 and a molecular weight of 424.59 g/mol. Its IUPAC name is 2-[[4-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine.
| Compound Name | 2-[[4-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine |
|---|---|
| PubChem CID | 109418882 |
| Molecular Formula | C19H28N4O3S2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 2-[[4-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(S(=O)(=O)N(C)C)cc1)NCC(C)(O)c1cccs1 |
| InChI | InChI=1S/C19H28N4O3S2/c1-5-20-18(22-14-19(2,24)17-7-6-12-27-17)21-13-15-8-10-16(11-9-15)28(25,26)23(3)4/h6-12,24H,5,13-14H2,1-4H3,(H2,20,21,22) |
| InChIKey | CAYUYYIBBTXVKF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|