C20H31N5OS — CID 109419992
2-[[6-(diethylamino)-3-pyridinyl]methyl]-1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine (PubChem CID 109419992) has the molecular formula C20H31N5OS and a molecular weight of 389.57 g/mol. Its IUPAC name is 2-[[6-(diethylamino)-3-pyridinyl]methyl]-1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine.
| Compound Name | 2-[[6-(diethylamino)-3-pyridinyl]methyl]-1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine |
|---|---|
| PubChem CID | 109419992 |
| Molecular Formula | C20H31N5OS |
| Molecular Weight | 389.57 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 2-[[6-(diethylamino)-3-pyridinyl]methyl]-1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(N(CC)CC)nc1)NCC(C)(O)c1cccs1 |
| InChI | InChI=1S/C20H31N5OS/c1-5-21-19(24-15-20(4,26)17-9-8-12-27-17)23-14-16-10-11-18(22-13-16)25(6-2)7-3/h8-13,26H,5-7,14-15H2,1-4H3,(H2,21,23,24) |
| InChIKey | IMLWVJUBYQVUQX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 72.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.57 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|