C17H22ClFIN3OS — CID 109419293
2-[(3-chloro-4-fluorophenyl)methyl]-1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide (PubChem CID 109419293) has the molecular formula C17H22ClFIN3OS and a molecular weight of 497.81 g/mol. Its IUPAC name is 2-[(3-chloro-4-fluorophenyl)methyl]-1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide.
| Compound Name | 2-[(3-chloro-4-fluorophenyl)methyl]-1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109419293 |
| Molecular Formula | C17H22ClFIN3OS |
| Molecular Weight | 497.81 g/mol |
| Exact Mass | 497.02 |
| IUPAC Name | 2-[(3-chloro-4-fluorophenyl)methyl]-1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(F)c(Cl)c1)NCC(C)(O)c1cccs1.I |
| InChI | InChI=1S/C17H21ClFN3OS.HI/c1-3-20-16(21-10-12-6-7-14(19)13(18)9-12)22-11-17(2,23)15-5-4-8-24-15;/h4-9,23H,3,10-11H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | YWLZWMPOTQXWQA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.81 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|