C16H22ClIN4OS — CID 109419607
2-[(6-chloro-3-pyridinyl)methyl]-1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide (PubChem CID 109419607) has the molecular formula C16H22ClIN4OS and a molecular weight of 480.80 g/mol. Its IUPAC name is 2-[(6-chloro-3-pyridinyl)methyl]-1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide.
| Compound Name | 2-[(6-chloro-3-pyridinyl)methyl]-1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109419607 |
| Molecular Formula | C16H22ClIN4OS |
| Molecular Weight | 480.80 g/mol |
| Exact Mass | 480.02 |
| IUPAC Name | 2-[(6-chloro-3-pyridinyl)methyl]-1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(Cl)nc1)NCC(C)(O)c1cccs1.I |
| InChI | InChI=1S/C16H21ClN4OS.HI/c1-3-18-15(20-10-12-6-7-14(17)19-9-12)21-11-16(2,22)13-5-4-8-23-13;/h4-9,22H,3,10-11H2,1-2H3,(H2,18,20,21);1H |
| InChIKey | JIMRQEIRTACITH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.80 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|