C16H23ClN6O — CID 111656374
2-[(6-chloro-3-pyridinyl)methyl]-1-ethyl-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]guanidine (PubChem CID 111656374) has the molecular formula C16H23ClN6O and a molecular weight of 350.85 g/mol. Its IUPAC name is 2-[(6-chloro-3-pyridinyl)methyl]-1-ethyl-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]guanidine.
| Compound Name | 2-[(6-chloro-3-pyridinyl)methyl]-1-ethyl-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111656374 |
| Molecular Formula | C16H23ClN6O |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 2-[(6-chloro-3-pyridinyl)methyl]-1-ethyl-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(Cl)nc1)NCC(C)(O)c1cnn(C)c1 |
| InChI | InChI=1S/C16H23ClN6O/c1-4-18-15(20-8-12-5-6-14(17)19-7-12)21-11-16(2,24)13-9-22-23(3)10-13/h5-7,9-10,24H,4,8,11H2,1-3H3,(H2,18,20,21) |
| InChIKey | DABGROZNXSVQCL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|