C18H25F3IN5O — CID 111656091
1-ethyl-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111656091) has the molecular formula C18H25F3IN5O and a molecular weight of 511.33 g/mol. Its IUPAC name is 1-ethyl-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111656091 |
| Molecular Formula | C18H25F3IN5O |
| Molecular Weight | 511.33 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | 1-ethyl-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(F)(F)F)cc1)NCC(C)(O)c1cnn(C)c1.I |
| InChI | InChI=1S/C18H24F3N5O.HI/c1-4-22-16(24-12-17(2,27)15-10-25-26(3)11-15)23-9-13-5-7-14(8-6-13)18(19,20)21;/h5-8,10-11,27H,4,9,12H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | VJZQBOSYGQAWIL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|