C21H33IN6OS — CID 111655485
1-ethyl-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-2-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111655485) has the molecular formula C21H33IN6OS and a molecular weight of 544.51 g/mol. Its IUPAC name is 1-ethyl-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-2-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-2-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111655485 |
| Molecular Formula | C21H33IN6OS |
| Molecular Weight | 544.51 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | 1-ethyl-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-2-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCSCC2)cc1)NCC(C)(O)c1cnn(C)c1.I |
| InChI | InChI=1S/C21H32N6OS.HI/c1-4-22-20(24-16-21(2,28)18-14-25-26(3)15-18)23-13-17-5-7-19(8-6-17)27-9-11-29-12-10-27;/h5-8,14-15,28H,4,9-13,16H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | DNDIVECVKPRDGA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 77.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.51 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|