C19H27F3IN5O2 — CID 111655887
1-ethyl-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-2-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111655887) has the molecular formula C19H27F3IN5O2 and a molecular weight of 541.36 g/mol. Its IUPAC name is 1-ethyl-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-2-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-2-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111655887 |
| Molecular Formula | C19H27F3IN5O2 |
| Molecular Weight | 541.36 g/mol |
| Exact Mass | 541.12 |
| IUPAC Name | 1-ethyl-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-2-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(OCC(F)(F)F)c1)NCC(C)(O)c1cnn(C)c1.I |
| InChI | InChI=1S/C19H26F3N5O2.HI/c1-4-23-17(25-12-18(2,28)15-10-26-27(3)11-15)24-9-14-6-5-7-16(8-14)29-13-19(20,21)22;/h5-8,10-11,28H,4,9,12-13H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | GOIHAYOPNYZXTK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|