C17H26N6O3S — CID 111656302
1-ethyl-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-2-[(3-sulfamoylphenyl)methyl]guanidine (PubChem CID 111656302) has the molecular formula C17H26N6O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is 1-ethyl-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-2-[(3-sulfamoylphenyl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-2-[(3-sulfamoylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111656302 |
| Molecular Formula | C17H26N6O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 1-ethyl-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-2-[(3-sulfamoylphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(S(N)(=O)=O)c1)NCC(C)(O)c1cnn(C)c1 |
| InChI | InChI=1S/C17H26N6O3S/c1-4-19-16(21-12-17(2,24)14-10-22-23(3)11-14)20-9-13-6-5-7-15(8-13)27(18,25)26/h5-8,10-11,24H,4,9,12H2,1-3H3,(H2,18,25,26)(H2,19,20,21) |
| InChIKey | NSWNCGFGPZGINJ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|