C20H30IN5O4 — CID 111656939
methyl 5-[[[ethylamino-[[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]amino]methylidene]amino]methyl]-2-methoxybenzoate;hydroiodide (PubChem CID 111656939) has the molecular formula C20H30IN5O4 and a molecular weight of 531.40 g/mol. Its IUPAC name is methyl 5-[[[ethylamino-[[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]amino]methylidene]amino]methyl]-2-methoxybenzoate;hydroiodide.
| Compound Name | methyl 5-[[[ethylamino-[[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]amino]methylidene]amino]methyl]-2-methoxybenzoate;hydroiodide |
|---|---|
| PubChem CID | 111656939 |
| Molecular Formula | C20H30IN5O4 |
| Molecular Weight | 531.40 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | methyl 5-[[[ethylamino-[[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]amino]methylidene]amino]methyl]-2-methoxybenzoate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(C(=O)OC)c1)NCC(C)(O)c1cnn(C)c1.I |
| InChI | InChI=1S/C20H29N5O4.HI/c1-6-21-19(23-13-20(2,27)15-11-24-25(3)12-15)22-10-14-7-8-17(28-4)16(9-14)18(26)29-5;/h7-9,11-12,27H,6,10,13H2,1-5H3,(H2,21,22,23);1H |
| InChIKey | DQRDJWHSIVAABL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|