C17H27F3IN3OS — CID 111609693
1-ethyl-3-(2-methyl-2-methylsulfanylpropyl)-2-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111609693) has the molecular formula C17H27F3IN3OS and a molecular weight of 505.39 g/mol. Its IUPAC name is 1-ethyl-3-(2-methyl-2-methylsulfanylpropyl)-2-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-methyl-2-methylsulfanylpropyl)-2-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111609693 |
| Molecular Formula | C17H27F3IN3OS |
| Molecular Weight | 505.39 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | 1-ethyl-3-(2-methyl-2-methylsulfanylpropyl)-2-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(OCC(F)(F)F)c1)NCC(C)(C)SC.I |
| InChI | InChI=1S/C17H26F3N3OS.HI/c1-5-21-15(23-11-16(2,3)25-4)22-10-13-7-6-8-14(9-13)24-12-17(18,19)20;/h6-9H,5,10-12H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | NPQVKQMAEMTGBB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.39 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|