C15H21F5IN3O — CID 109474490
2-[[3-(2,2-difluoroethoxy)phenyl]methyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109474490) has the molecular formula C15H21F5IN3O and a molecular weight of 481.25 g/mol. Its IUPAC name is 2-[[3-(2,2-difluoroethoxy)phenyl]methyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 2-[[3-(2,2-difluoroethoxy)phenyl]methyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109474490 |
| Molecular Formula | C15H21F5IN3O |
| Molecular Weight | 481.25 g/mol |
| Exact Mass | 481.06 |
| IUPAC Name | 2-[[3-(2,2-difluoroethoxy)phenyl]methyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(OCC(F)F)c1)NCCC(F)(F)F.I |
| InChI | InChI=1S/C15H20F5N3O.HI/c1-2-21-14(22-7-6-15(18,19)20)23-9-11-4-3-5-12(8-11)24-10-13(16)17;/h3-5,8,13H,2,6-7,9-10H2,1H3,(H2,21,22,23);1H |
| InChIKey | CPXZVTUIKZEIAC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.25 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|