C18H30F2IN3O3 — CID 111406834
2-[[3-(2,2-difluoroethoxy)phenyl]methyl]-1-ethyl-3-[3-(2-methoxyethoxy)propyl]guanidine;hydroiodide (PubChem CID 111406834) has the molecular formula C18H30F2IN3O3 and a molecular weight of 501.36 g/mol. Its IUPAC name is 2-[[3-(2,2-difluoroethoxy)phenyl]methyl]-1-ethyl-3-[3-(2-methoxyethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 2-[[3-(2,2-difluoroethoxy)phenyl]methyl]-1-ethyl-3-[3-(2-methoxyethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111406834 |
| Molecular Formula | C18H30F2IN3O3 |
| Molecular Weight | 501.36 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | 2-[[3-(2,2-difluoroethoxy)phenyl]methyl]-1-ethyl-3-[3-(2-methoxyethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(OCC(F)F)c1)NCCCOCCOC.I |
| InChI | InChI=1S/C18H29F2N3O3.HI/c1-3-21-18(22-8-5-9-25-11-10-24-2)23-13-15-6-4-7-16(12-15)26-14-17(19)20;/h4,6-7,12,17H,3,5,8-11,13-14H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | GZIZIYUHWYNPDN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|