C15H24F2IN3OS — CID 111346058
2-[[3-(2,2-difluoroethoxy)phenyl]methyl]-1-ethyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide (PubChem CID 111346058) has the molecular formula C15H24F2IN3OS and a molecular weight of 459.34 g/mol. Its IUPAC name is 2-[[3-(2,2-difluoroethoxy)phenyl]methyl]-1-ethyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide.
| Compound Name | 2-[[3-(2,2-difluoroethoxy)phenyl]methyl]-1-ethyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111346058 |
| Molecular Formula | C15H24F2IN3OS |
| Molecular Weight | 459.34 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | 2-[[3-(2,2-difluoroethoxy)phenyl]methyl]-1-ethyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(OCC(F)F)c1)NCCSC.I |
| InChI | InChI=1S/C15H23F2N3OS.HI/c1-3-18-15(19-7-8-22-2)20-10-12-5-4-6-13(9-12)21-11-14(16)17;/h4-6,9,14H,3,7-8,10-11H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | HCHKVXSLNHKWMP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|